C14H31IN4O — CID 111009854
N,N-diethyl-2-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111009854) has the molecular formula C14H31IN4O and a molecular weight of 398.33 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111009854 |
| Molecular Formula | C14H31IN4O |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C14H30N4O.HI/c1-7-15-14(16-10-12(4)5)17(6)11-13(19)18(8-2)9-3;/h12H,7-11H2,1-6H3,(H,15,16);1H |
| InChIKey | CKWFEIXONKFKKB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|