C16H36IN5O3S — CID 111010470
N,N-diethyl-2-[[N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111010470) has the molecular formula C16H36IN5O3S and a molecular weight of 505.47 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111010470 |
| Molecular Formula | C16H36IN5O3S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN(CC)S(C)(=O)=O)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C16H35N5O3S.HI/c1-7-17-16(19(5)14-15(22)20(8-2)9-3)18-12-11-13-21(10-4)25(6,23)24;/h7-14H2,1-6H3,(H,17,18);1H |
| InChIKey | NHQVTPIFYVKTMN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|