C14H31IN4O2 — CID 111010490
2-[[N'-(2-ethoxyethyl)-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide (PubChem CID 111010490) has the molecular formula C14H31IN4O2 and a molecular weight of 414.33 g/mol. Its IUPAC name is 2-[[N'-(2-ethoxyethyl)-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-(2-ethoxyethyl)-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111010490 |
| Molecular Formula | C14H31IN4O2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-[[N'-(2-ethoxyethyl)-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CCOCC)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C14H30N4O2.HI/c1-6-15-14(16-10-11-20-9-4)17(5)12-13(19)18(7-2)8-3;/h6-12H2,1-5H3,(H,15,16);1H |
| InChIKey | JGDHZXPQTYCPML-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|