C16H35IN4O2 — CID 111009584
N,N-diethyl-2-[[N-ethyl-N'-(5-methoxypentyl)carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111009584) has the molecular formula C16H35IN4O2 and a molecular weight of 442.39 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-(5-methoxypentyl)carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-(5-methoxypentyl)carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111009584 |
| Molecular Formula | C16H35IN4O2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-(5-methoxypentyl)carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCCOC)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C16H34N4O2.HI/c1-6-17-16(18-12-10-9-11-13-22-5)19(4)14-15(21)20(7-2)8-3;/h6-14H2,1-5H3,(H,17,18);1H |
| InChIKey | JIODUZSJHMABSC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|