C20H33N5O2 — CID 111009965
N-[3-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]propyl]benzamide (PubChem CID 111009965) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[3-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]propyl]benzamide.
| Compound Name | N-[3-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]propyl]benzamide |
|---|---|
| PubChem CID | 111009965 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | N-[3-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]propyl]benzamide |
| SMILES | CCN/C(=N\CCCNC(=O)c1ccccc1)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C20H33N5O2/c1-5-21-20(24(4)16-18(26)25(6-2)7-3)23-15-11-14-22-19(27)17-12-9-8-10-13-17/h8-10,12-13H,5-7,11,14-16H2,1-4H3,(H,21,23)(H,22,27) |
| InChIKey | MWCRSAYUEJZVFZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|