C18H30N6O2 — CID 111009397
N-[2-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide (PubChem CID 111009397) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is N-[2-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 111009397 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | N-[2-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide |
| SMILES | CCN/C(=N\CCNC(=O)c1cccnc1)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C18H30N6O2/c1-5-20-18(23(4)14-16(25)24(6-2)7-3)22-12-11-21-17(26)15-9-8-10-19-13-15/h8-10,13H,5-7,11-12,14H2,1-4H3,(H,20,22)(H,21,26) |
| InChIKey | RKQBBGXYHBMSSD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|