C19H33N5O3 — CID 111009529
N,N-diethyl-2-[[N-ethyl-N'-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide (PubChem CID 111009529) has the molecular formula C19H33N5O3 and a molecular weight of 379.51 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 111009529 |
| Molecular Formula | C19H33N5O3 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide |
| SMILES | CCN/C(=N\Cc1cccnc1OCCOC)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C19H33N5O3/c1-6-20-19(23(4)15-17(25)24(7-2)8-3)22-14-16-10-9-11-21-18(16)27-13-12-26-5/h9-11H,6-8,12-15H2,1-5H3,(H,20,22) |
| InChIKey | DTHMRASLNNZBQN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|