C24H42N6O — CID 111009655
N,N-diethyl-2-[[N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]carbamimidoyl]-methylamino]acetamide (PubChem CID 111009655) has the molecular formula C24H42N6O and a molecular weight of 430.64 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]carbamimidoyl]-methylamino]acetamide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]carbamimidoyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 111009655 |
| Molecular Formula | C24H42N6O |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]carbamimidoyl]-methylamino]acetamide |
| SMILES | CCN/C(=N\CCCCN1CCN(c2ccccc2)CC1)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C24H42N6O/c1-5-25-24(27(4)21-23(31)29(6-2)7-3)26-15-11-12-16-28-17-19-30(20-18-28)22-13-9-8-10-14-22/h8-10,13-14H,5-7,11-12,15-21H2,1-4H3,(H,25,26) |
| InChIKey | KXYRXYRERSOCJJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|