C25H45IN6O — CID 111009658
N,N-diethyl-2-[[N-ethyl-N'-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111009658) has the molecular formula C25H45IN6O and a molecular weight of 572.58 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111009658 |
| Molecular Formula | C25H45IN6O |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1CCN(c2cccc(C)c2)CC1)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C25H44N6O.HI/c1-6-26-25(28(5)21-24(32)30(7-2)8-3)27-14-9-10-15-29-16-18-31(19-17-29)23-13-11-12-22(4)20-23;/h11-13,20H,6-10,14-19,21H2,1-5H3,(H,26,27);1H |
| InChIKey | AABXYFNFAGWBMX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|