C18H34N6O — CID 111010005
2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide (PubChem CID 111010005) has the molecular formula C18H34N6O and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 111010005 |
| Molecular Formula | C18H34N6O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C18H34N6O/c1-7-19-18(22(6)14-17(25)23(8-2)9-3)20-11-10-12-24-16(5)13-15(4)21-24/h13H,7-12,14H2,1-6H3,(H,19,20) |
| InChIKey | ZMLUCTGREXAECU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|