C20H35N5O — CID 111009883
2-[[N'-[2-(dimethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide (PubChem CID 111009883) has the molecular formula C20H35N5O and a molecular weight of 361.53 g/mol. Its IUPAC name is 2-[[N'-[2-(dimethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[[N'-[2-(dimethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 111009883 |
| Molecular Formula | C20H35N5O |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 2-[[N'-[2-(dimethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
| SMILES | CCN/C(=N\CC(c1ccccc1)N(C)C)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C20H35N5O/c1-7-21-20(24(6)16-19(26)25(8-2)9-3)22-15-18(23(4)5)17-13-11-10-12-14-17/h10-14,18H,7-9,15-16H2,1-6H3,(H,21,22) |
| InChIKey | PVZAZFALCXVMBG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|