C22H39N5O3 — CID 111010021
2-[[N'-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide (PubChem CID 111010021) has the molecular formula C22H39N5O3 and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-[[N'-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[[N'-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 111010021 |
| Molecular Formula | C22H39N5O3 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | 2-[[N'-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)c(OC)c1)N(C)C)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C22H39N5O3/c1-9-23-22(26(6)16-21(28)27(10-2)11-3)24-15-18(25(4)5)17-12-13-19(29-7)20(14-17)30-8/h12-14,18H,9-11,15-16H2,1-8H3,(H,23,24) |
| InChIKey | NZXNYBTUASBAAR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|