C19H35IN4O3 — CID 111897138
2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-1-(2-ethoxyethyl)-3-ethylguanidine;hydroiodide (PubChem CID 111897138) has the molecular formula C19H35IN4O3 and a molecular weight of 494.42 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-1-(2-ethoxyethyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-1-(2-ethoxyethyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111897138 |
| Molecular Formula | C19H35IN4O3 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-1-(2-ethoxyethyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)c(OC)c1)N(C)C)NCCOCC.I |
| InChI | InChI=1S/C19H34N4O3.HI/c1-7-20-19(21-11-12-26-8-2)22-14-16(23(3)4)15-9-10-17(24-5)18(13-15)25-6;/h9-10,13,16H,7-8,11-12,14H2,1-6H3,(H2,20,21,22);1H |
| InChIKey | ZYLRXEHWZKBECO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|