C13H22N4O2 — CID 110884502
2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]guanidine (PubChem CID 110884502) has the molecular formula C13H22N4O2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]guanidine.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 110884502 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]guanidine |
| SMILES | COc1ccc(C(CN=C(N)N)N(C)C)cc1OC |
| InChI | InChI=1S/C13H22N4O2/c1-17(2)10(8-16-13(14)15)9-5-6-11(18-3)12(7-9)19-4/h5-7,10H,8H2,1-4H3,(H4,14,15,16) |
| InChIKey | UBSFDVQFYNFARD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|