C21H39IN4O3 — CID 111946090
2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-1-(4-ethoxybutyl)-3-ethylguanidine;hydroiodide (PubChem CID 111946090) has the molecular formula C21H39IN4O3 and a molecular weight of 522.47 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-1-(4-ethoxybutyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-1-(4-ethoxybutyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111946090 |
| Molecular Formula | C21H39IN4O3 |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-1-(4-ethoxybutyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)c(OC)c1)N(C)C)NCCCCOCC.I |
| InChI | InChI=1S/C21H38N4O3.HI/c1-7-22-21(23-13-9-10-14-28-8-2)24-16-18(25(3)4)17-11-12-19(26-5)20(15-17)27-6;/h11-12,15,18H,7-10,13-14,16H2,1-6H3,(H2,22,23,24);1H |
| InChIKey | PLQAGIYLGFINER-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|