C20H35IN4O4 — CID 111010348
N,N-diethyl-2-[[N-ethyl-N'-[(2,4,6-trimethoxyphenyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111010348) has the molecular formula C20H35IN4O4 and a molecular weight of 522.43 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[(2,4,6-trimethoxyphenyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[(2,4,6-trimethoxyphenyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111010348 |
| Molecular Formula | C20H35IN4O4 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[(2,4,6-trimethoxyphenyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(OC)cc(OC)cc1OC)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C20H34N4O4.HI/c1-8-21-20(23(4)14-19(25)24(9-2)10-3)22-13-16-17(27-6)11-15(26-5)12-18(16)28-7;/h11-12H,8-10,13-14H2,1-7H3,(H,21,22);1H |
| InChIKey | ZRTNZQODAFZFMY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|