C22H30FN5O2 — CID 111009789
N,N-diethyl-2-[[N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide (PubChem CID 111009789) has the molecular formula C22H30FN5O2 and a molecular weight of 415.51 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 111009789 |
| Molecular Formula | C22H30FN5O2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide |
| SMILES | CCN/C(=N\Cc1ccnc(Oc2ccc(F)cc2)c1)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C22H30FN5O2/c1-5-24-22(27(4)16-21(29)28(6-2)7-3)26-15-17-12-13-25-20(14-17)30-19-10-8-18(23)9-11-19/h8-14H,5-7,15-16H2,1-4H3,(H,24,26) |
| InChIKey | HHXSKQVAUMITTD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|