C19H29F3N4O — CID 111009757
N,N-diethyl-2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]-methylamino]acetamide (PubChem CID 111009757) has the molecular formula C19H29F3N4O and a molecular weight of 386.46 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]-methylamino]acetamide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 111009757 |
| Molecular Formula | C19H29F3N4O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]-methylamino]acetamide |
| SMILES | CCN/C(=N\CCc1ccc(C(F)(F)F)cc1)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C19H29F3N4O/c1-5-23-18(25(4)14-17(27)26(6-2)7-3)24-13-12-15-8-10-16(11-9-15)19(20,21)22/h8-11H,5-7,12-14H2,1-4H3,(H,23,24) |
| InChIKey | LXSKQVWKZJQECE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|