C19H23N5S — CID 109423414
1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(2-quinolin-8-ylethyl)guanidine (PubChem CID 109423414) has the molecular formula C19H23N5S and a molecular weight of 353.50 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(2-quinolin-8-ylethyl)guanidine.
| Compound Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(2-quinolin-8-ylethyl)guanidine |
|---|---|
| PubChem CID | 109423414 |
| Molecular Formula | C19H23N5S |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(2-quinolin-8-ylethyl)guanidine |
| SMILES | C/N=C(/NCCc1cccc2cccnc12)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C19H23N5S/c1-14-23-17(13-25-14)12-24(3)19(20-2)22-11-9-16-7-4-6-15-8-5-10-21-18(15)16/h4-8,10,13H,9,11-12H2,1-3H3,(H,20,22) |
| InChIKey | KRNXBJOQMULAFN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|