C20H25IN4S — CID 109421689
1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(2-naphthalen-1-ylethyl)guanidine;hydroiodide (PubChem CID 109421689) has the molecular formula C20H25IN4S and a molecular weight of 480.42 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(2-naphthalen-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(2-naphthalen-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421689 |
| Molecular Formula | C20H25IN4S |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-(2-naphthalen-1-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cccc2ccccc12)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C20H24N4S.HI/c1-15-23-18(14-25-15)13-24(3)20(21-2)22-12-11-17-9-6-8-16-7-4-5-10-19(16)17;/h4-10,14H,11-13H2,1-3H3,(H,21,22);1H |
| InChIKey | KJDZXYBRJKZPOO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|