C18H25BrN4O2S — CID 109423730
2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109423730) has the molecular formula C18H25BrN4O2S and a molecular weight of 441.40 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109423730 |
| Molecular Formula | C18H25BrN4O2S |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1Br)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C18H25BrN4O2S/c1-6-20-18(23(3)10-14-11-26-12(2)22-14)21-9-13-7-16(24-4)17(25-5)8-15(13)19/h7-8,11H,6,9-10H2,1-5H3,(H,20,21) |
| InChIKey | MQKSDJOFFWLZFV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|