C18H27N5OS — CID 109424864
3-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109424864) has the molecular formula C18H27N5OS and a molecular weight of 361.52 g/mol. Its IUPAC name is 3-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109424864 |
| Molecular Formula | C18H27N5OS |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 3-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C)c(OC)c1C)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C18H27N5OS/c1-7-19-18(23(5)10-15-11-25-14(4)22-15)21-9-16-13(3)17(24-6)12(2)8-20-16/h8,11H,7,9-10H2,1-6H3,(H,19,21) |
| InChIKey | QDCCJVMVPOPNEP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|