C18H31IN4O — CID 109498913
3-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109498913) has the molecular formula C18H31IN4O and a molecular weight of 446.38 g/mol. Its IUPAC name is 3-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109498913 |
| Molecular Formula | C18H31IN4O |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 3-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-methyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/Cc1ncc(C)c(OC)c1C)NCC.I |
| InChI | InChI=1S/C18H30N4O.HI/c1-7-9-10-11-22(5)18(19-8-2)21-13-16-15(4)17(23-6)14(3)12-20-16;/h7,12H,1,8-11,13H2,2-6H3,(H,19,21);1H |
| InChIKey | BOZDLLITIMOZPK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|