C14H25IN4O — CID 111087496
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111087496) has the molecular formula C14H25IN4O and a molecular weight of 392.29 g/mol. Its IUPAC name is 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111087496 |
| Molecular Formula | C14H25IN4O |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | COc1c(C)cnc(CN=C(N(C)C)N(C)C)c1C.I |
| InChI | InChI=1S/C14H24N4O.HI/c1-10-8-15-12(11(2)13(10)19-7)9-16-14(17(3)4)18(5)6;/h8H,9H2,1-7H3;1H |
| InChIKey | HWKVLDDIWZGOST-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|