C13H23IN4O — CID 111087456
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-propylguanidine;hydroiodide (PubChem CID 111087456) has the molecular formula C13H23IN4O and a molecular weight of 378.26 g/mol. Its IUPAC name is 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-propylguanidine;hydroiodide.
| Compound Name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111087456 |
| Molecular Formula | C13H23IN4O |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-1-propylguanidine;hydroiodide |
| SMILES | CCCN/C(N)=N/Cc1ncc(C)c(OC)c1C.I |
| InChI | InChI=1S/C13H22N4O.HI/c1-5-6-15-13(14)17-8-11-10(3)12(18-4)9(2)7-16-11;/h7H,5-6,8H2,1-4H3,(H3,14,15,17);1H |
| InChIKey | GZIFXJOLXFWMQE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|