C10H17N5 — CID 62846130
2-[(5-methylpyrazin-2-yl)methyl]-1-propylguanidine (PubChem CID 62846130) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is 2-[(5-methylpyrazin-2-yl)methyl]-1-propylguanidine.
| Compound Name | 2-[(5-methylpyrazin-2-yl)methyl]-1-propylguanidine |
|---|---|
| PubChem CID | 62846130 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 2-[(5-methylpyrazin-2-yl)methyl]-1-propylguanidine |
| SMILES | CCCN/C(N)=N/Cc1cnc(C)cn1 |
| InChI | InChI=1S/C10H17N5/c1-3-4-12-10(11)15-7-9-6-13-8(2)5-14-9/h5-6H,3-4,7H2,1-2H3,(H3,11,12,15) |
| InChIKey | OOFFGNZMVCVUKU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|