C8H15N5O — CID 103734481
2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1-propylguanidine (PubChem CID 103734481) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1-propylguanidine.
| Compound Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1-propylguanidine |
|---|---|
| PubChem CID | 103734481 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1-propylguanidine |
| SMILES | CCCN/C(N)=N/Cc1noc(C)n1 |
| InChI | InChI=1S/C8H15N5O/c1-3-4-10-8(9)11-5-7-12-6(2)14-13-7/h3-5H2,1-2H3,(H3,9,10,11) |
| InChIKey | VKXHJEQTHKJYCH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|