C10H17F3IN5O — CID 111986772
1-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111986772) has the molecular formula C10H17F3IN5O and a molecular weight of 407.18 g/mol. Its IUPAC name is 1-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111986772 |
| Molecular Formula | C10H17F3IN5O |
| Molecular Weight | 407.18 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 1-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1noc(C)n1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C10H16F3N5O.HI/c1-3-14-9(15-5-4-10(11,12)13)16-6-8-17-7(2)19-18-8;/h3-6H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | FOMVODJMDABRNI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|