C16H24IN5O2 — CID 109417113
1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 109417113) has the molecular formula C16H24IN5O2 and a molecular weight of 445.31 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109417113 |
| Molecular Formula | C16H24IN5O2 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1noc(C)n1)NCC(C)(O)c1ccccc1.I |
| InChI | InChI=1S/C16H23N5O2.HI/c1-4-17-15(18-10-14-20-12(2)23-21-14)19-11-16(3,22)13-8-6-5-7-9-13;/h5-9,22H,4,10-11H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | UISOCVOTSMOSCJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|