C14H22IN5O2S — CID 111654151
1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111654151) has the molecular formula C14H22IN5O2S and a molecular weight of 451.33 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111654151 |
| Molecular Formula | C14H22IN5O2S |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)no1)NCC(C)(O)c1ccsc1.I |
| InChI | InChI=1S/C14H21N5O2S.HI/c1-4-15-13(16-7-12-18-10(2)19-21-12)17-9-14(3,20)11-5-6-22-8-11;/h5-6,8,20H,4,7,9H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | SQLKFAPRZJLALV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|