C19H25F3IN3O2S — CID 111653955
1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111653955) has the molecular formula C19H25F3IN3O2S and a molecular weight of 543.39 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111653955 |
| Molecular Formula | C19H25F3IN3O2S |
| Molecular Weight | 543.39 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCC(C)(O)c1ccsc1.I |
| InChI | InChI=1S/C19H24F3N3O2S.HI/c1-3-23-17(25-12-18(2,26)15-8-9-28-11-15)24-10-14-4-6-16(7-5-14)27-13-19(20,21)22;/h4-9,11,26H,3,10,12-13H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | QFRGRFPMKQEMJT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|