C20H29IN4O3S2 — CID 111653869
2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111653869) has the molecular formula C20H29IN4O3S2 and a molecular weight of 564.52 g/mol. Its IUPAC name is 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111653869 |
| Molecular Formula | C20H29IN4O3S2 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)NC2CC2)cc1)NCC(C)(O)c1ccsc1.I |
| InChI | InChI=1S/C20H28N4O3S2.HI/c1-3-21-19(23-14-20(2,25)16-10-11-28-13-16)22-12-15-4-8-18(9-5-15)29(26,27)24-17-6-7-17;/h4-5,8-11,13,17,24-25H,3,6-7,12,14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | RUAGKTFKZIRQRG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|