C20H29IN4O2S — CID 111654361
N-ethyl-3-[[[ethylamino-[(2-hydroxy-2-thiophen-3-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111654361) has the molecular formula C20H29IN4O2S and a molecular weight of 516.45 g/mol. Its IUPAC name is N-ethyl-3-[[[ethylamino-[(2-hydroxy-2-thiophen-3-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-ethyl-3-[[[ethylamino-[(2-hydroxy-2-thiophen-3-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111654361 |
| Molecular Formula | C20H29IN4O2S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | N-ethyl-3-[[[ethylamino-[(2-hydroxy-2-thiophen-3-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCNC(=O)c1cccc(C/N=C(\NCC)NCC(C)(O)c2ccsc2)c1.I |
| InChI | InChI=1S/C20H28N4O2S.HI/c1-4-21-18(25)16-8-6-7-15(11-16)12-23-19(22-5-2)24-14-20(3,26)17-9-10-27-13-17;/h6-11,13,26H,4-5,12,14H2,1-3H3,(H,21,25)(H2,22,23,24);1H |
| InChIKey | MDBUGSNYGNEXLZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|