C20H29IN4OS — CID 111704127
N-ethyl-3-[[[ethylamino-(2-thiophen-3-ylpropylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111704127) has the molecular formula C20H29IN4OS and a molecular weight of 500.45 g/mol. Its IUPAC name is N-ethyl-3-[[[ethylamino-(2-thiophen-3-ylpropylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-ethyl-3-[[[ethylamino-(2-thiophen-3-ylpropylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111704127 |
| Molecular Formula | C20H29IN4OS |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | N-ethyl-3-[[[ethylamino-(2-thiophen-3-ylpropylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCNC(=O)c1cccc(C/N=C(\NCC)NCC(C)c2ccsc2)c1.I |
| InChI | InChI=1S/C20H28N4OS.HI/c1-4-21-19(25)17-8-6-7-16(11-17)13-24-20(22-5-2)23-12-15(3)18-9-10-26-14-18;/h6-11,14-15H,4-5,12-13H2,1-3H3,(H,21,25)(H2,22,23,24);1H |
| InChIKey | CWGINPZKFCMJRY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|