C18H23N3O3S — CID 111654432
2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine (PubChem CID 111654432) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111654432 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCC(C)(O)c1ccsc1 |
| InChI | InChI=1S/C18H23N3O3S/c1-3-19-17(21-11-18(2,22)14-6-7-25-10-14)20-9-13-4-5-15-16(8-13)24-12-23-15/h4-8,10,22H,3,9,11-12H2,1-2H3,(H2,19,20,21) |
| InChIKey | HFEIQAQRCKFEIK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|