C22H29N3O3 — CID 109417784
2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-1-ethyl-3-(2-hydroxy-2-phenylpropyl)guanidine (PubChem CID 109417784) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-1-ethyl-3-(2-hydroxy-2-phenylpropyl)guanidine.
| Compound Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-1-ethyl-3-(2-hydroxy-2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 109417784 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-1-ethyl-3-(2-hydroxy-2-phenylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCCCO2)NCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O3/c1-3-23-21(25-16-22(2,26)18-8-5-4-6-9-18)24-15-17-10-11-19-20(14-17)28-13-7-12-27-19/h4-6,8-11,14,26H,3,7,12-13,15-16H2,1-2H3,(H2,23,24,25) |
| InChIKey | SQNAOJWRMICOER-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|