C20H26FN3O2 — CID 109418456
1-ethyl-2-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-3-(2-hydroxy-2-phenylpropyl)guanidine (PubChem CID 109418456) has the molecular formula C20H26FN3O2 and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-ethyl-2-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-3-(2-hydroxy-2-phenylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-3-(2-hydroxy-2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 109418456 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-ethyl-2-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-3-(2-hydroxy-2-phenylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)c(CO)c1)NCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C20H26FN3O2/c1-3-22-19(23-12-15-9-10-18(21)16(11-15)13-25)24-14-20(2,26)17-7-5-4-6-8-17/h4-11,25-26H,3,12-14H2,1-2H3,(H2,22,23,24) |
| InChIKey | AGBSQKHZQULBHR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|