C15H24IN5O3 — CID 111663508
1-ethyl-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111663508) has the molecular formula C15H24IN5O3 and a molecular weight of 449.29 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111663508 |
| Molecular Formula | C15H24IN5O3 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)no1)NCC(C)(O)c1ccc(C)o1.I |
| InChI | InChI=1S/C15H23N5O3.HI/c1-5-16-14(17-8-13-19-11(3)20-23-13)18-9-15(4,21)12-7-6-10(2)22-12;/h6-7,21H,5,8-9H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | XBOPQGLLQXERQR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|