C19H29N5O3 — CID 109416836
2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-hydroxy-2-phenylpropyl)guanidine (PubChem CID 109416836) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-hydroxy-2-phenylpropyl)guanidine.
| Compound Name | 2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-hydroxy-2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 109416836 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-hydroxy-2-phenylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1nc(C(C)OCC)no1)NCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C19H29N5O3/c1-5-20-18(22-13-19(4,25)15-10-8-7-9-11-15)21-12-16-23-17(24-27-16)14(3)26-6-2/h7-11,14,25H,5-6,12-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | STJUBRATGBHTPT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|