C19H29N5O2 — CID 109417642
1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 109417642) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109417642 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NCCc1nc(C(C)C)no1 |
| InChI | InChI=1S/C19H29N5O2/c1-5-20-18(21-12-11-16-23-17(14(2)3)24-26-16)22-13-19(4,25)15-9-7-6-8-10-15/h6-10,14,25H,5,11-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | VMSTXSVAQHLWMH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|