C17H24FN5O — CID 111554585
1-ethyl-2-[(4-fluorophenyl)methyl]-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 111554585) has the molecular formula C17H24FN5O and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-ethyl-2-[(4-fluorophenyl)methyl]-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(4-fluorophenyl)methyl]-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111554585 |
| Molecular Formula | C17H24FN5O |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 1-ethyl-2-[(4-fluorophenyl)methyl]-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCCc1nc(C(C)C)no1 |
| InChI | InChI=1S/C17H24FN5O/c1-4-19-17(21-11-13-5-7-14(18)8-6-13)20-10-9-15-22-16(12(2)3)23-24-15/h5-8,12H,4,9-11H2,1-3H3,(H2,19,20,21) |
| InChIKey | WCNTVVKSVDZDEC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|