C16H25N5OS — CID 111554283
1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 111554283) has the molecular formula C16H25N5OS and a molecular weight of 335.48 g/mol. Its IUPAC name is 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111554283 |
| Molecular Formula | C16H25N5OS |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCCc1nc(C(C)C)no1 |
| InChI | InChI=1S/C16H25N5OS/c1-5-17-16(19-10-13-7-6-12(4)23-13)18-9-8-14-20-15(11(2)3)21-22-14/h6-7,11H,5,8-10H2,1-4H3,(H2,17,18,19) |
| InChIKey | SKCQMFBFVPIXTB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|