C18H25F2N5O2 — CID 111516021
1-[1-(3,4-difluorophenyl)ethyl]-2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine (PubChem CID 111516021) has the molecular formula C18H25F2N5O2 and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111516021 |
| Molecular Formula | C18H25F2N5O2 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1nc(C(C)OCC)no1)NC(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H25F2N5O2/c1-5-21-18(23-11(3)13-7-8-14(19)15(20)9-13)22-10-16-24-17(25-27-16)12(4)26-6-2/h7-9,11-12H,5-6,10H2,1-4H3,(H2,21,22,23) |
| InChIKey | HLYRCJLSORGXHH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|