C16H25BrIN5O2S — CID 111517235
1-[(5-bromothiophen-2-yl)methyl]-2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 111517235) has the molecular formula C16H25BrIN5O2S and a molecular weight of 558.28 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111517235 |
| Molecular Formula | C16H25BrIN5O2S |
| Molecular Weight | 558.28 g/mol |
| Exact Mass | 557.00 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C(C)OCC)no1)N(C)Cc1ccc(Br)s1.I |
| InChI | InChI=1S/C16H24BrN5O2S.HI/c1-5-18-16(22(4)10-12-7-8-13(17)25-12)19-9-14-20-15(21-24-14)11(3)23-6-2;/h7-8,11H,5-6,9-10H2,1-4H3,(H,18,19);1H |
| InChIKey | YDZXDFQGPQQITP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|