C18H24BrN3O2S — CID 111363493
1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-1-methylguanidine (PubChem CID 111363493) has the molecular formula C18H24BrN3O2S and a molecular weight of 426.38 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-1-methylguanidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111363493 |
| Molecular Formula | C18H24BrN3O2S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC)cc1)N(C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C18H24BrN3O2S/c1-4-20-18(22(2)12-15-9-10-17(19)25-15)21-11-16(23)13-5-7-14(24-3)8-6-13/h5-10,16,23H,4,11-12H2,1-3H3,(H,20,21) |
| InChIKey | NFYQDMNPIWLTDZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|