C16H22BrN3O2S — CID 111517244
1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-1-methylguanidine (PubChem CID 111517244) has the molecular formula C16H22BrN3O2S and a molecular weight of 400.34 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-1-methylguanidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111517244 |
| Molecular Formula | C16H22BrN3O2S |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)N(C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C16H22BrN3O2S/c1-4-18-15(20(3)10-12-7-8-14(17)23-12)19-11-16(2,21)13-6-5-9-22-13/h5-9,21H,4,10-11H2,1-3H3,(H,18,19) |
| InChIKey | BWGPMNGLFKIWNG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|