C16H24BrIN4O2S — CID 111501256
1-[(5-bromothiophen-2-yl)methyl]-2-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 111501256) has the molecular formula C16H24BrIN4O2S and a molecular weight of 543.27 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-2-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-2-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111501256 |
| Molecular Formula | C16H24BrIN4O2S |
| Molecular Weight | 543.27 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-2-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1C(=O)CCCC1=O)N(C)Cc1ccc(Br)s1.I |
| InChI | InChI=1S/C16H23BrN4O2S.HI/c1-3-18-16(20(2)11-12-7-8-13(17)24-12)19-9-10-21-14(22)5-4-6-15(21)23;/h7-8H,3-6,9-11H2,1-2H3,(H,18,19);1H |
| InChIKey | LZISITNREOFZIX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|