C12H19BrIN3S — CID 119153479
1-[(5-bromothiophen-2-yl)methyl]-3-cyclobutyl-1,2-dimethylguanidine;hydroiodide (PubChem CID 119153479) has the molecular formula C12H19BrIN3S and a molecular weight of 444.18 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-cyclobutyl-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-cyclobutyl-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119153479 |
| Molecular Formula | C12H19BrIN3S |
| Molecular Weight | 444.18 g/mol |
| Exact Mass | 442.95 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-cyclobutyl-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NC1CCC1)N(C)Cc1ccc(Br)s1.I |
| InChI | InChI=1S/C12H18BrN3S.HI/c1-14-12(15-9-4-3-5-9)16(2)8-10-6-7-11(13)17-10;/h6-7,9H,3-5,8H2,1-2H3,(H,14,15);1H |
| InChIKey | CEACLXSFOSNRMM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.18 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|