C16H22IN3O — CID 119153693
1-(1-benzofuran-2-ylmethyl)-3-cyclobutyl-1,2-dimethylguanidine;hydroiodide (PubChem CID 119153693) has the molecular formula C16H22IN3O and a molecular weight of 399.28 g/mol. Its IUPAC name is 1-(1-benzofuran-2-ylmethyl)-3-cyclobutyl-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-(1-benzofuran-2-ylmethyl)-3-cyclobutyl-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119153693 |
| Molecular Formula | C16H22IN3O |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 1-(1-benzofuran-2-ylmethyl)-3-cyclobutyl-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NC1CCC1)N(C)Cc1cc2ccccc2o1.I |
| InChI | InChI=1S/C16H21N3O.HI/c1-17-16(18-13-7-5-8-13)19(2)11-14-10-12-6-3-4-9-15(12)20-14;/h3-4,6,9-10,13H,5,7-8,11H2,1-2H3,(H,17,18);1H |
| InChIKey | QACVEHYCVWECAU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|