C15H23IN4O3S — CID 86778288
1-(1-benzofuran-2-ylmethyl)-3-[2-(methanesulfonamido)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 86778288) has the molecular formula C15H23IN4O3S and a molecular weight of 466.35 g/mol. Its IUPAC name is 1-(1-benzofuran-2-ylmethyl)-3-[2-(methanesulfonamido)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-(1-benzofuran-2-ylmethyl)-3-[2-(methanesulfonamido)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 86778288 |
| Molecular Formula | C15H23IN4O3S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 1-(1-benzofuran-2-ylmethyl)-3-[2-(methanesulfonamido)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCNS(C)(=O)=O)N(C)Cc1cc2ccccc2o1.I |
| InChI | InChI=1S/C15H22N4O3S.HI/c1-16-15(17-8-9-18-23(3,20)21)19(2)11-13-10-12-6-4-5-7-14(12)22-13;/h4-7,10,18H,8-9,11H2,1-3H3,(H,16,17);1H |
| InChIKey | WMMGYCCYLPQRLT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|